C13H21F3N2O — CID 155794372
1-[4-tert-butyl-2-(2,2,2-trifluoroethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 155794372) has the molecular formula C13H21F3N2O and a molecular weight of 278.32 g/mol. Its IUPAC name is 1-[4-tert-butyl-2-(2,2,2-trifluoroethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-tert-butyl-2-(2,2,2-trifluoroethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155794372 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-[4-tert-butyl-2-(2,2,2-trifluoroethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(C)(C)C)CC1CC(F)(F)F |
| InChI | InChI=1S/C13H21F3N2O/c1-5-11(19)18-7-6-17(12(2,3)4)9-10(18)8-13(14,15)16/h5,10H,1,6-9H2,2-4H3 |
| InChIKey | TYEDOVLUHXBQPG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|