C10H14F3NO2 — CID 155325540
1-[(2R,4S)-4-methyl-2-(trifluoromethoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 155325540) has the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. Its IUPAC name is 1-[(2R,4S)-4-methyl-2-(trifluoromethoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R,4S)-4-methyl-2-(trifluoromethoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155325540 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1-[(2R,4S)-4-methyl-2-(trifluoromethoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@@H](C)C[C@@H]1COC(F)(F)F |
| InChI | InChI=1S/C10H14F3NO2/c1-3-9(15)14-5-7(2)4-8(14)6-16-10(11,12)13/h3,7-8H,1,4-6H2,2H3/t7-,8+/m0/s1 |
| InChIKey | JUSXJJMTTJBQQI-JGVFFNPUSA-N |
| XLogP | 1.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|