C12H22O2S — CID 146652579
5-(2-methylpropyl)-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene 2,2-dioxide (PubChem CID 146652579) has the molecular formula C12H22O2S and a molecular weight of 230.37 g/mol. Its IUPAC name is 5-(2-methylpropyl)-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene 2,2-dioxide.
| Compound Name | 5-(2-methylpropyl)-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene 2,2-dioxide |
|---|---|
| PubChem CID | 146652579 |
| Molecular Formula | C12H22O2S |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 5-(2-methylpropyl)-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene 2,2-dioxide |
| SMILES | CC(C)CC1CCC2CS(=O)(=O)CC2C1 |
| InChI | InChI=1S/C12H22O2S/c1-9(2)5-10-3-4-11-7-15(13,14)8-12(11)6-10/h9-12H,3-8H2,1-2H3 |
| InChIKey | DINQGMTYOLCBLF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |