C17H23BrFIO5S — CID 146654128
(3R,4R)-5-(4-bromophenyl)sulfonyl-4-fluoro-3-(1-iodoethoxy)-2-(propan-2-yloxymethyl)oxane (PubChem CID 146654128) has the molecular formula C17H23BrFIO5S and a molecular weight of 565.24 g/mol. Its IUPAC name is (3R,4R)-5-(4-bromophenyl)sulfonyl-4-fluoro-3-(1-iodoethoxy)-2-(propan-2-yloxymethyl)oxane.
| Compound Name | (3R,4R)-5-(4-bromophenyl)sulfonyl-4-fluoro-3-(1-iodoethoxy)-2-(propan-2-yloxymethyl)oxane |
|---|---|
| PubChem CID | 146654128 |
| Molecular Formula | C17H23BrFIO5S |
| Molecular Weight | 565.24 g/mol |
| Exact Mass | 563.95 |
| IUPAC Name | (3R,4R)-5-(4-bromophenyl)sulfonyl-4-fluoro-3-(1-iodoethoxy)-2-(propan-2-yloxymethyl)oxane |
| SMILES | CC(C)OCC1OCC(S(=O)(=O)c2ccc(Br)cc2)[C@H](F)[C@@H]1OC(C)I |
| InChI | InChI=1S/C17H23BrFIO5S/c1-10(2)23-8-14-17(25-11(3)20)16(19)15(9-24-14)26(21,22)13-6-4-12(18)5-7-13/h4-7,10-11,14-17H,8-9H2,1-3H3/t11?,14?,15?,16-,17+/m0/s1 |
| InChIKey | DHWXDXWEVMOFHM-OLANPKAQSA-N |
| XLogP | 3.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.24 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|