C16H23BrO4S2 — CID 146233443
1-[(2S)-5-(4-bromophenyl)sulfonyl-2-(propan-2-yloxymethyl)oxolan-2-yl]ethanethiol (PubChem CID 146233443) has the molecular formula C16H23BrO4S2 and a molecular weight of 423.39 g/mol. Its IUPAC name is 1-[(2S)-5-(4-bromophenyl)sulfonyl-2-(propan-2-yloxymethyl)oxolan-2-yl]ethanethiol.
| Compound Name | 1-[(2S)-5-(4-bromophenyl)sulfonyl-2-(propan-2-yloxymethyl)oxolan-2-yl]ethanethiol |
|---|---|
| PubChem CID | 146233443 |
| Molecular Formula | C16H23BrO4S2 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 1-[(2S)-5-(4-bromophenyl)sulfonyl-2-(propan-2-yloxymethyl)oxolan-2-yl]ethanethiol |
| SMILES | CC(C)OC[C@]1(C(C)S)CCC(S(=O)(=O)c2ccc(Br)cc2)O1 |
| InChI | InChI=1S/C16H23BrO4S2/c1-11(2)20-10-16(12(3)22)9-8-15(21-16)23(18,19)14-6-4-13(17)5-7-14/h4-7,11-12,15,22H,8-10H2,1-3H3/t12?,15?,16-/m0/s1 |
| InChIKey | FMLPFVMZECDMLC-MOQPWLNLSA-N |
| XLogP | 3.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|