C26H37BrO10S — CID 126587211
[(3S,5S)-2-acetyloxy-5-[1-(4-bromophenyl)sulfonyloxycyclopropyl]-4-butoxy-5-(butoxymethyl)oxolan-3-yl] acetate (PubChem CID 126587211) has the molecular formula C26H37BrO10S and a molecular weight of 621.54 g/mol. Its IUPAC name is [(3S,5S)-2-acetyloxy-5-[1-(4-bromophenyl)sulfonyloxycyclopropyl]-4-butoxy-5-(butoxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(3S,5S)-2-acetyloxy-5-[1-(4-bromophenyl)sulfonyloxycyclopropyl]-4-butoxy-5-(butoxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 126587211 |
| Molecular Formula | C26H37BrO10S |
| Molecular Weight | 621.54 g/mol |
| Exact Mass | 620.13 |
| IUPAC Name | [(3S,5S)-2-acetyloxy-5-[1-(4-bromophenyl)sulfonyloxycyclopropyl]-4-butoxy-5-(butoxymethyl)oxolan-3-yl] acetate |
| SMILES | CCCCOC[C@]1(C2(OS(=O)(=O)c3ccc(Br)cc3)CC2)OC(OC(C)=O)[C@@H](OC(C)=O)C1OCCCC |
| InChI | InChI=1S/C26H37BrO10S/c1-5-7-15-32-17-26(25(13-14-25)37-38(30,31)21-11-9-20(27)10-12-21)23(33-16-8-6-2)22(34-18(3)28)24(36-26)35-19(4)29/h9-12,22-24H,5-8,13-17H2,1-4H3/t22-,23?,24?,26-/m0/s1 |
| InChIKey | UUZOWVKUFSSOFM-IDABCOFVSA-N |
| XLogP | 4.28 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|