C23H28N2O6 — CID 146657254
(4S,4aR,6S)-6-ethenyl-4-(ethylamino)-1,3,10,11-tetrahydroxy-12-oxo-4,4a,5,5a,6,6a,7,12a-octahydro-1H-tetracene-2-carboxamide (PubChem CID 146657254) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is (4S,4aR,6S)-6-ethenyl-4-(ethylamino)-1,3,10,11-tetrahydroxy-12-oxo-4,4a,5,5a,6,6a,7,12a-octahydro-1H-tetracene-2-carboxamide.
| Compound Name | (4S,4aR,6S)-6-ethenyl-4-(ethylamino)-1,3,10,11-tetrahydroxy-12-oxo-4,4a,5,5a,6,6a,7,12a-octahydro-1H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 146657254 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (4S,4aR,6S)-6-ethenyl-4-(ethylamino)-1,3,10,11-tetrahydroxy-12-oxo-4,4a,5,5a,6,6a,7,12a-octahydro-1H-tetracene-2-carboxamide |
| SMILES | C=C[C@H]1C2CC=CC(O)=C2C(O)=C2C(=O)C3C(O)C(C(N)=O)=C(O)[C@@H](NCC)[C@@H]3CC21 |
| InChI | InChI=1S/C23H28N2O6/c1-3-9-10-6-5-7-13(26)14(10)19(27)15-11(9)8-12-16(20(15)28)21(29)17(23(24)31)22(30)18(12)25-4-2/h3,5,7,9-12,16,18,21,25-27,29-30H,1,4,6,8H2,2H3,(H2,24,31)/t9-,10?,11?,12+,16?,18-,21?/m0/s1 |
| InChIKey | ALDDJPDGQFFSFH-SEFLQJFGSA-N |
| XLogP | 1.47 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|