C21H23N3O6 — CID 70804507
(7R)-8,12-dihydroxy-3-methyl-7-(methylaminomethyl)-1,10,11-trioxo-5,5a,6,6a,7,10a-hexahydro-2H-naphtho[2,3-g]isoquinoline-9-carboxamide (PubChem CID 70804507) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is (7R)-8,12-dihydroxy-3-methyl-7-(methylaminomethyl)-1,10,11-trioxo-5,5a,6,6a,7,10a-hexahydro-2H-naphtho[2,3-g]isoquinoline-9-carboxamide.
| Compound Name | (7R)-8,12-dihydroxy-3-methyl-7-(methylaminomethyl)-1,10,11-trioxo-5,5a,6,6a,7,10a-hexahydro-2H-naphtho[2,3-g]isoquinoline-9-carboxamide |
|---|---|
| PubChem CID | 70804507 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | (7R)-8,12-dihydroxy-3-methyl-7-(methylaminomethyl)-1,10,11-trioxo-5,5a,6,6a,7,10a-hexahydro-2H-naphtho[2,3-g]isoquinoline-9-carboxamide |
| SMILES | CNC[C@@H]1C(O)=C(C(N)=O)C(=O)C2C(=O)C3=C(O)c4c(cc(C)[nH]c4=O)CC3CC21 |
| InChI | InChI=1S/C21H23N3O6/c1-7-3-8-4-9-5-10-11(6-23-2)16(25)15(20(22)29)19(28)14(10)18(27)12(9)17(26)13(8)21(30)24-7/h3,9-11,14,23,25-26H,4-6H2,1-2H3,(H2,22,29)(H,24,30)/t9?,10?,11-,14?/m0/s1 |
| InChIKey | KNSYHBDMUSBBKB-DGVZPSOQSA-N |
| XLogP | 0.05 |
| TPSA | 162.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|