C9H18O8 — CID 146657328
2,3,4,5-tetrahydroxy-3,4,5-trimethoxyhexanal (PubChem CID 146657328) has the molecular formula C9H18O8 and a molecular weight of 254.23 g/mol. Its IUPAC name is 2,3,4,5-tetrahydroxy-3,4,5-trimethoxyhexanal.
| Compound Name | 2,3,4,5-tetrahydroxy-3,4,5-trimethoxyhexanal |
|---|---|
| PubChem CID | 146657328 |
| Molecular Formula | C9H18O8 |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2,3,4,5-tetrahydroxy-3,4,5-trimethoxyhexanal |
| SMILES | COC(C)(O)C(O)(OC)C(O)(OC)C(O)C=O |
| InChI | InChI=1S/C9H18O8/c1-7(12,15-2)9(14,17-4)8(13,16-3)6(11)5-10/h5-6,11-14H,1-4H3 |
| InChIKey | PQNNLVZOARXACK-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|