About 5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate
5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate (PubChem CID 146659879) has the molecular formula C12H18O5
and a molecular weight of 242.27 g/mol. Its IUPAC name is 5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate.
Molecular Properties
| Compound Name | 5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate |
| PubChem CID | 146659879 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate |
| SMILES | COC(=O)C/C=C/C(=O)OC1CCCCCO1 |
| InChI | InChI=1S/C12H18O5/c1-15-10(13)6-5-7-11(14)17-12-8-3-2-4-9-16-12/h5,7,12H,2-4,6,8-9H2,1H3/b7-5+ |
| InChIKey | HQSNOWIZUPQHBB-FNORWQNLSA-N |
| XLogP | 1.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate?
The IUPAC name of 5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate (CID 146659879) is 5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate.
What is the SMILES notation for 5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate?
The canonical SMILES for 5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate is COC(=O)C/C=C/C(=O)OC1CCCCCO1.
What is the InChIKey of 5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate?
The InChIKey is HQSNOWIZUPQHBB-FNORWQNLSA-N. The full InChI is InChI=1S/C12H18O5/c1-15-10(13)6-5-7-11(14)17-12-8-3-2-4-9-16-12/h5,7,12H,2-4,6,8-9H2,1H3/b7-5+.
What are the key properties of 5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate?
5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate has a molecular weight of 242.27 g/mol, XLogP of 1.57, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-methyl 1-O-(oxepan-2-yl) (E)-pent-2-enedioate is sourced from PubChem (CID 146659879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).