C20H32N2O11PS+ — CID 146660224
[(2R,3R,4R)-4-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-4-(2-methoxyethoxy)oxolan-3-yl]oxy-(2-ethylbutoxycarbonyloxymethylsulfanyl)-oxophosphanium (PubChem CID 146660224) has the molecular formula C20H32N2O11PS+ and a molecular weight of 539.52 g/mol. Its IUPAC name is [(2R,3R,4R)-4-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-4-(2-methoxyethoxy)oxolan-3-yl]oxy-(2-ethylbutoxycarbonyloxymethylsulfanyl)-oxophosphanium.
| Compound Name | [(2R,3R,4R)-4-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-4-(2-methoxyethoxy)oxolan-3-yl]oxy-(2-ethylbutoxycarbonyloxymethylsulfanyl)-oxophosphanium |
|---|---|
| PubChem CID | 146660224 |
| Molecular Formula | C20H32N2O11PS+ |
| Molecular Weight | 539.52 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | [(2R,3R,4R)-4-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-4-(2-methoxyethoxy)oxolan-3-yl]oxy-(2-ethylbutoxycarbonyloxymethylsulfanyl)-oxophosphanium |
| SMILES | CCC(CC)COC(=O)OCS[P+](=O)O[C@@H]1[C@@H](CO)OC[C@]1(OCCOC)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C20H31N2O11PS/c1-4-14(5-2)11-29-19(26)31-13-35-34(27)33-17-15(10-23)30-12-20(17,32-9-8-28-3)22-7-6-16(24)21-18(22)25/h6-7,14-15,17,23H,4-5,8-13H2,1-3H3/p+1/t15-,17-,20-/m1/s1 |
| InChIKey | JXHXMLYGSYUDNT-WRWLIDTKSA-O |
| XLogP | 1.57 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.52 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|