C12H17N2O8P — CID 177041326
[(E)-2-[(2R)-4-(2,4-dioxopyrimidin-1-yl)-3,4-dimethoxyoxolan-2-yl]ethenyl]phosphonic acid (PubChem CID 177041326) has the molecular formula C12H17N2O8P and a molecular weight of 348.25 g/mol. Its IUPAC name is [(E)-2-[(2R)-4-(2,4-dioxopyrimidin-1-yl)-3,4-dimethoxyoxolan-2-yl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[(2R)-4-(2,4-dioxopyrimidin-1-yl)-3,4-dimethoxyoxolan-2-yl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 177041326 |
| Molecular Formula | C12H17N2O8P |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | [(E)-2-[(2R)-4-(2,4-dioxopyrimidin-1-yl)-3,4-dimethoxyoxolan-2-yl]ethenyl]phosphonic acid |
| SMILES | COC1[C@@H](/C=C/P(=O)(O)O)OCC1(OC)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17N2O8P/c1-20-10-8(4-6-23(17,18)19)22-7-12(10,21-2)14-5-3-9(15)13-11(14)16/h3-6,8,10H,7H2,1-2H3,(H,13,15,16)(H2,17,18,19)/b6-4+/t8-,10?,12?/m1/s1 |
| InChIKey | IADUNIQJORWRFL-VHMWOKHXSA-N |
| XLogP | -1.06 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|