C13H19N2O8PS — CID 172550658
1-[(2R,3R,4R,5R)-2-cyclopropyl-4-dihydroxyphosphinothioyloxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 172550658) has the molecular formula C13H19N2O8PS and a molecular weight of 394.34 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-2-cyclopropyl-4-dihydroxyphosphinothioyloxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-2-cyclopropyl-4-dihydroxyphosphinothioyloxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 172550658 |
| Molecular Formula | C13H19N2O8PS |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-2-cyclopropyl-4-dihydroxyphosphinothioyloxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CO[C@@H]1[C@H](OP(O)(O)=S)[C@@H](CO)O[C@@]1(C1CC1)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C13H19N2O8PS/c1-21-11-10(23-24(19,20)25)8(6-16)22-13(11,7-2-3-7)15-5-4-9(17)14-12(15)18/h4-5,7-8,10-11,16H,2-3,6H2,1H3,(H,14,17,18)(H2,19,20,25)/t8-,10-,11-,13-/m1/s1 |
| InChIKey | OSMJLZMPRUTCTP-UORFTKCHSA-N |
| XLogP | -1.40 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|