C15H24N2O10P2S — CID 170365031
[(E)-2-[(1R,2R,3S)-4-(2,4-dioxopyrimidin-1-yl)-2-[hydroxy(2-methylsulfanylethoxy)phosphoryl]oxy-3-methoxycyclopentyl]ethenyl]phosphonic acid (PubChem CID 170365031) has the molecular formula C15H24N2O10P2S and a molecular weight of 486.38 g/mol. Its IUPAC name is [(E)-2-[(1R,2R,3S)-4-(2,4-dioxopyrimidin-1-yl)-2-[hydroxy(2-methylsulfanylethoxy)phosphoryl]oxy-3-methoxycyclopentyl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[(1R,2R,3S)-4-(2,4-dioxopyrimidin-1-yl)-2-[hydroxy(2-methylsulfanylethoxy)phosphoryl]oxy-3-methoxycyclopentyl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 170365031 |
| Molecular Formula | C15H24N2O10P2S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | [(E)-2-[(1R,2R,3S)-4-(2,4-dioxopyrimidin-1-yl)-2-[hydroxy(2-methylsulfanylethoxy)phosphoryl]oxy-3-methoxycyclopentyl]ethenyl]phosphonic acid |
| SMILES | CO[C@H]1C(n2ccc(=O)[nH]c2=O)C[C@H](/C=C/P(=O)(O)O)[C@H]1OP(=O)(O)OCCSC |
| InChI | InChI=1S/C15H24N2O10P2S/c1-25-14-11(17-5-3-12(18)16-15(17)19)9-10(4-7-28(20,21)22)13(14)27-29(23,24)26-6-8-30-2/h3-5,7,10-11,13-14H,6,8-9H2,1-2H3,(H,23,24)(H,16,18,19)(H2,20,21,22)/b7-4+/t10-,11?,13+,14-/m0/s1 |
| InChIKey | LSQXBBHOLHBYMH-KOCQCYLYSA-N |
| XLogP | 0.67 |
| TPSA | 177.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|