C15H26N2O9P2S — CID 170364546
2-[(1R,2R,3S,4R)-4-(2,4-dioxopyrimidin-1-yl)-2-[hydroxy(propan-2-yloxy)phosphinothioyl]oxy-3-methoxycyclopentyl]ethylphosphonic acid (PubChem CID 170364546) has the molecular formula C15H26N2O9P2S and a molecular weight of 472.39 g/mol. Its IUPAC name is 2-[(1R,2R,3S,4R)-4-(2,4-dioxopyrimidin-1-yl)-2-[hydroxy(propan-2-yloxy)phosphinothioyl]oxy-3-methoxycyclopentyl]ethylphosphonic acid.
| Compound Name | 2-[(1R,2R,3S,4R)-4-(2,4-dioxopyrimidin-1-yl)-2-[hydroxy(propan-2-yloxy)phosphinothioyl]oxy-3-methoxycyclopentyl]ethylphosphonic acid |
|---|---|
| PubChem CID | 170364546 |
| Molecular Formula | C15H26N2O9P2S |
| Molecular Weight | 472.39 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 2-[(1R,2R,3S,4R)-4-(2,4-dioxopyrimidin-1-yl)-2-[hydroxy(propan-2-yloxy)phosphinothioyl]oxy-3-methoxycyclopentyl]ethylphosphonic acid |
| SMILES | CO[C@@H]1[C@H](OP(O)(=S)OC(C)C)[C@@H](CCP(=O)(O)O)C[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C15H26N2O9P2S/c1-9(2)25-28(23,29)26-13-10(5-7-27(20,21)22)8-11(14(13)24-3)17-6-4-12(18)16-15(17)19/h4,6,9-11,13-14H,5,7-8H2,1-3H3,(H,23,29)(H,16,18,19)(H2,20,21,22)/t10-,11+,13+,14-,28?/m0/s1 |
| InChIKey | BCHIBZSXDXRKFG-FWIZMBNMSA-N |
| XLogP | 0.71 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.39 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|