C13H20N2O9P2S — CID 170365171
[(E)-2-[(1R,2R,3S,4S)-4-(2,4-dioxopyrimidin-1-yl)-2-[hydroxy(methoxy)phosphinothioyl]oxy-3-methoxycyclopentyl]ethenyl]phosphonic acid (PubChem CID 170365171) has the molecular formula C13H20N2O9P2S and a molecular weight of 442.32 g/mol. Its IUPAC name is [(E)-2-[(1R,2R,3S,4S)-4-(2,4-dioxopyrimidin-1-yl)-2-[hydroxy(methoxy)phosphinothioyl]oxy-3-methoxycyclopentyl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[(1R,2R,3S,4S)-4-(2,4-dioxopyrimidin-1-yl)-2-[hydroxy(methoxy)phosphinothioyl]oxy-3-methoxycyclopentyl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 170365171 |
| Molecular Formula | C13H20N2O9P2S |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | [(E)-2-[(1R,2R,3S,4S)-4-(2,4-dioxopyrimidin-1-yl)-2-[hydroxy(methoxy)phosphinothioyl]oxy-3-methoxycyclopentyl]ethenyl]phosphonic acid |
| SMILES | CO[C@@H]1[C@H](OP(O)(=S)OC)[C@@H](/C=C/P(=O)(O)O)C[C@@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C13H20N2O9P2S/c1-22-12-9(15-5-3-10(16)14-13(15)17)7-8(4-6-25(18,19)20)11(12)24-26(21,27)23-2/h3-6,8-9,11-12H,7H2,1-2H3,(H,21,27)(H,14,16,17)(H2,18,19,20)/b6-4+/t8-,9-,11+,12-,26?/m0/s1 |
| InChIKey | PBSGGSZIICXKHP-DGTKDPALSA-N |
| XLogP | 0.05 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|