About CID 174148102
CID 174148102 (PubChem CID 174148102) has the molecular formula C12H23BO7P2S
and a molecular weight of 384.14 g/mol.
Molecular Properties
| Compound Name | CID 174148102 |
| PubChem CID | 174148102 |
| Molecular Formula | C12H23BO7P2S |
| Molecular Weight | 384.14 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@H](/C=C/P(=O)(O)O)[C@@H](OC)[C@H]1OP(O)(=S)OC(C)(C)C |
| InChI | InChI=1S/C12H23BO7P2S/c1-12(2,3)20-22(17,23)19-11-9(13)7-8(10(11)18-4)5-6-21(14,15)16/h5-6,8-11H,7H2,1-4H3,(H,17,23)(H2,14,15,16)/b6-5+/t8-,9-,10+,11-,22?/m0/s1 |
| InChIKey | KOZBYVUGSTVLBQ-LMIYTUKNSA-N |
| XLogP | 2.09 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.14 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 174148102 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174148102?
The IUPAC name of CID 174148102 (CID 174148102) is not available.
What is the SMILES notation for CID 174148102?
The canonical SMILES for CID 174148102 is [B][C@H]1C[C@H](/C=C/P(=O)(O)O)[C@@H](OC)[C@H]1OP(O)(=S)OC(C)(C)C.
What is the InChIKey of CID 174148102?
The InChIKey is KOZBYVUGSTVLBQ-LMIYTUKNSA-N. The full InChI is InChI=1S/C12H23BO7P2S/c1-12(2,3)20-22(17,23)19-11-9(13)7-8(10(11)18-4)5-6-21(14,15)16/h5-6,8-11H,7H2,1-4H3,(H,17,23)(H2,14,15,16)/b6-5+/t8-,9-,10+,11-,22?/m0/s1.
What are the key properties of CID 174148102?
CID 174148102 has a molecular weight of 384.14 g/mol, XLogP of 2.09, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174148102 is sourced from PubChem (CID 174148102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).