C12H23BO7P2S — CID 174148102
CID 174148102 (PubChem CID 174148102) has the molecular formula C12H23BO7P2S and a molecular weight of 384.14 g/mol.
| Compound Name | CID 174148102 |
|---|---|
| PubChem CID | 174148102 |
| Molecular Formula | C12H23BO7P2S |
| Molecular Weight | 384.14 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@H](/C=C/P(=O)(O)O)[C@@H](OC)[C@H]1OP(O)(=S)OC(C)(C)C |
| InChI | InChI=1S/C12H23BO7P2S/c1-12(2,3)20-22(17,23)19-11-9(13)7-8(10(11)18-4)5-6-21(14,15)16/h5-6,8-11H,7H2,1-4H3,(H,17,23)(H2,14,15,16)/b6-5+/t8-,9-,10+,11-,22?/m0/s1 |
| InChIKey | KOZBYVUGSTVLBQ-LMIYTUKNSA-N |
| XLogP | 2.09 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.14 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|