C11H23BO7P2S — CID 174148134
CID 174148134 (PubChem CID 174148134) has the molecular formula C11H23BO7P2S and a molecular weight of 372.13 g/mol.
| Compound Name | CID 174148134 |
|---|---|
| PubChem CID | 174148134 |
| Molecular Formula | C11H23BO7P2S |
| Molecular Weight | 372.13 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1C[C@H](CCP(=O)(O)OC)[C@@H](OP(O)(=S)OCC)[C@H]1OC |
| InChI | InChI=1S/C11H23BO7P2S/c1-4-18-21(15,22)19-10-8(5-6-20(13,14)17-3)7-9(12)11(10)16-2/h8-11H,4-7H2,1-3H3,(H,13,14)(H,15,22)/t8-,9+,10+,11-,21?/m0/s1 |
| InChIKey | MREDDQDLMIGKFW-RETDTWDXSA-N |
| XLogP | 1.84 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.13 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|