C11H22NO5PS2 — CID 174088307
N-[(1S,2R,4R)-3-[hydroxy(methoxy)phosphinothioyl]oxy-2-methoxy-4-(methoxymethyl)cyclopentyl]ethanethioamide (PubChem CID 174088307) has the molecular formula C11H22NO5PS2 and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[(1S,2R,4R)-3-[hydroxy(methoxy)phosphinothioyl]oxy-2-methoxy-4-(methoxymethyl)cyclopentyl]ethanethioamide.
| Compound Name | N-[(1S,2R,4R)-3-[hydroxy(methoxy)phosphinothioyl]oxy-2-methoxy-4-(methoxymethyl)cyclopentyl]ethanethioamide |
|---|---|
| PubChem CID | 174088307 |
| Molecular Formula | C11H22NO5PS2 |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-[(1S,2R,4R)-3-[hydroxy(methoxy)phosphinothioyl]oxy-2-methoxy-4-(methoxymethyl)cyclopentyl]ethanethioamide |
| SMILES | COC[C@H]1C[C@H](NC(C)=S)[C@@H](OC)C1OP(O)(=S)OC |
| InChI | InChI=1S/C11H22NO5PS2/c1-7(19)12-9-5-8(6-14-2)10(11(9)15-3)17-18(13,20)16-4/h8-11H,5-6H2,1-4H3,(H,12,19)(H,13,20)/t8-,9+,10?,11-,18?/m1/s1 |
| InChIKey | BSNLKIDVJXNBJL-KYOJWBIVSA-N |
| XLogP | 1.22 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|