C18H26NO9P — CID 174088356
[(1R,2S,4S)-4-acetamido-2-[hydroxy(methoxy)phosphoryl]oxy-3-methoxycyclopentyl]methyl benzyl carbonate (PubChem CID 174088356) has the molecular formula C18H26NO9P and a molecular weight of 431.38 g/mol. Its IUPAC name is [(1R,2S,4S)-4-acetamido-2-[hydroxy(methoxy)phosphoryl]oxy-3-methoxycyclopentyl]methyl benzyl carbonate.
| Compound Name | [(1R,2S,4S)-4-acetamido-2-[hydroxy(methoxy)phosphoryl]oxy-3-methoxycyclopentyl]methyl benzyl carbonate |
|---|---|
| PubChem CID | 174088356 |
| Molecular Formula | C18H26NO9P |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | [(1R,2S,4S)-4-acetamido-2-[hydroxy(methoxy)phosphoryl]oxy-3-methoxycyclopentyl]methyl benzyl carbonate |
| SMILES | COC1[C@@H](NC(C)=O)C[C@H](COC(=O)OCc2ccccc2)[C@@H]1OP(=O)(O)OC |
| InChI | InChI=1S/C18H26NO9P/c1-12(20)19-15-9-14(16(17(15)24-2)28-29(22,23)25-3)11-27-18(21)26-10-13-7-5-4-6-8-13/h4-8,14-17H,9-11H2,1-3H3,(H,19,20)(H,22,23)/t14-,15+,16+,17?/m1/s1 |
| InChIKey | DQORZFIWUVCWBI-WTYVYLTKSA-N |
| XLogP | 2.01 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|