C23H29N2O11P — CID 174088321
benzyl [(1R,3R,4R)-4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-[hydroxy(methoxy)phosphoryl]oxy-3-methoxycyclopentyl]methyl carbonate (PubChem CID 174088321) has the molecular formula C23H29N2O11P and a molecular weight of 540.46 g/mol. Its IUPAC name is benzyl [(1R,3R,4R)-4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-[hydroxy(methoxy)phosphoryl]oxy-3-methoxycyclopentyl]methyl carbonate.
| Compound Name | benzyl [(1R,3R,4R)-4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-[hydroxy(methoxy)phosphoryl]oxy-3-methoxycyclopentyl]methyl carbonate |
|---|---|
| PubChem CID | 174088321 |
| Molecular Formula | C23H29N2O11P |
| Molecular Weight | 540.46 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | benzyl [(1R,3R,4R)-4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-[hydroxy(methoxy)phosphoryl]oxy-3-methoxycyclopentyl]methyl carbonate |
| SMILES | CO[C@H]1C(OP(=O)(O)OC)[C@@H](COC(=O)OCc2ccccc2)C[C@H]1NC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C23H29N2O11P/c1-32-22-17(24-18(26)10-11-25-19(27)8-9-20(25)28)12-16(21(22)36-37(30,31)33-2)14-35-23(29)34-13-15-6-4-3-5-7-15/h3-9,16-17,21-22H,10-14H2,1-2H3,(H,24,26)(H,30,31)/t16-,17-,21?,22-/m1/s1 |
| InChIKey | ZOZPLYYTQNWRMJ-OWNVQEPFSA-N |
| XLogP | 1.31 |
| TPSA | 167.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|