C11H23N2O5PS2 — CID 174088302
1-[(1R,2R,4R)-3-[hydroxy(methoxy)phosphinothioyl]oxy-2-methoxy-4-(methoxymethyl)cyclopentyl]-3-methylthiourea (PubChem CID 174088302) has the molecular formula C11H23N2O5PS2 and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-[(1R,2R,4R)-3-[hydroxy(methoxy)phosphinothioyl]oxy-2-methoxy-4-(methoxymethyl)cyclopentyl]-3-methylthiourea.
| Compound Name | 1-[(1R,2R,4R)-3-[hydroxy(methoxy)phosphinothioyl]oxy-2-methoxy-4-(methoxymethyl)cyclopentyl]-3-methylthiourea |
|---|---|
| PubChem CID | 174088302 |
| Molecular Formula | C11H23N2O5PS2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1-[(1R,2R,4R)-3-[hydroxy(methoxy)phosphinothioyl]oxy-2-methoxy-4-(methoxymethyl)cyclopentyl]-3-methylthiourea |
| SMILES | CNC(=S)N[C@@H]1C[C@H](COC)C(OP(O)(=S)OC)[C@@H]1OC |
| InChI | InChI=1S/C11H23N2O5PS2/c1-12-11(20)13-8-5-7(6-15-2)9(10(8)16-3)18-19(14,21)17-4/h7-10H,5-6H2,1-4H3,(H,14,21)(H2,12,13,20)/t7-,8-,9?,10-,19?/m1/s1 |
| InChIKey | AQBCMGSRGBROCP-UZLUOVHFSA-N |
| XLogP | 0.38 |
| TPSA | 81.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|