C16H26N3O8PS — CID 168847546
[(2R,3R,5R)-3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamothioylamino]-2-methoxy-5-(methoxymethyl)cyclopentyl] methyl hydrogen phosphate (PubChem CID 168847546) has the molecular formula C16H26N3O8PS and a molecular weight of 451.44 g/mol. Its IUPAC name is [(2R,3R,5R)-3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamothioylamino]-2-methoxy-5-(methoxymethyl)cyclopentyl] methyl hydrogen phosphate.
| Compound Name | [(2R,3R,5R)-3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamothioylamino]-2-methoxy-5-(methoxymethyl)cyclopentyl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 168847546 |
| Molecular Formula | C16H26N3O8PS |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | [(2R,3R,5R)-3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamothioylamino]-2-methoxy-5-(methoxymethyl)cyclopentyl] methyl hydrogen phosphate |
| SMILES | COC[C@H]1C[C@@H](NC(=S)NCCN2C(=O)C=CC2=O)[C@@H](OC)C1OP(=O)(O)OC |
| InChI | InChI=1S/C16H26N3O8PS/c1-24-9-10-8-11(15(25-2)14(10)27-28(22,23)26-3)18-16(29)17-6-7-19-12(20)4-5-13(19)21/h4-5,10-11,14-15H,6-9H2,1-3H3,(H,22,23)(H2,17,18,29)/t10-,11-,14?,15-/m1/s1 |
| InChIKey | QMYCUUNDUSGFFW-BXYFAJDVSA-N |
| XLogP | -0.44 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|