C15H23N3O5S — CID 168847448
1-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-[(1R,2R,4R)-3-hydroxy-2-methoxy-4-(methoxymethyl)cyclopentyl]thiourea (PubChem CID 168847448) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is 1-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-[(1R,2R,4R)-3-hydroxy-2-methoxy-4-(methoxymethyl)cyclopentyl]thiourea.
| Compound Name | 1-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-[(1R,2R,4R)-3-hydroxy-2-methoxy-4-(methoxymethyl)cyclopentyl]thiourea |
|---|---|
| PubChem CID | 168847448 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-[(1R,2R,4R)-3-hydroxy-2-methoxy-4-(methoxymethyl)cyclopentyl]thiourea |
| SMILES | COC[C@H]1C[C@@H](NC(=S)NCCN2C(=O)C=CC2=O)[C@@H](OC)C1O |
| InChI | InChI=1S/C15H23N3O5S/c1-22-8-9-7-10(14(23-2)13(9)21)17-15(24)16-5-6-18-11(19)3-4-12(18)20/h3-4,9-10,13-14,21H,5-8H2,1-2H3,(H2,16,17,24)/t9-,10-,13?,14-/m1/s1 |
| InChIKey | YOMOAKRNPVIOON-MNPOPGLPSA-N |
| XLogP | -1.21 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|