C23H40N4O7P2 — CID 172557056
3-[[(1R,2S,3R,5R)-5-(2-dimethoxyphosphorylethyl)-3-(2,4-dioxopyrimidin-1-yl)-2-methoxycyclopentyl]-di(propan-2-yl)phosphorylamino]propanenitrile (PubChem CID 172557056) has the molecular formula C23H40N4O7P2 and a molecular weight of 546.54 g/mol. Its IUPAC name is 3-[[(1R,2S,3R,5R)-5-(2-dimethoxyphosphorylethyl)-3-(2,4-dioxopyrimidin-1-yl)-2-methoxycyclopentyl]-di(propan-2-yl)phosphorylamino]propanenitrile.
| Compound Name | 3-[[(1R,2S,3R,5R)-5-(2-dimethoxyphosphorylethyl)-3-(2,4-dioxopyrimidin-1-yl)-2-methoxycyclopentyl]-di(propan-2-yl)phosphorylamino]propanenitrile |
|---|---|
| PubChem CID | 172557056 |
| Molecular Formula | C23H40N4O7P2 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 3-[[(1R,2S,3R,5R)-5-(2-dimethoxyphosphorylethyl)-3-(2,4-dioxopyrimidin-1-yl)-2-methoxycyclopentyl]-di(propan-2-yl)phosphorylamino]propanenitrile |
| SMILES | CO[C@@H]1[C@H](N(CCC#N)P(=O)(C(C)C)C(C)C)[C@@H](CCP(=O)(OC)OC)C[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C23H40N4O7P2/c1-16(2)36(31,17(3)4)27(12-8-11-24)21-18(10-14-35(30,33-6)34-7)15-19(22(21)32-5)26-13-9-20(28)25-23(26)29/h9,13,16-19,21-22H,8,10,12,14-15H2,1-7H3,(H,25,28,29)/t18-,19+,21+,22-/m0/s1 |
| InChIKey | AIYOEJXHZTYXFC-PSBKLILYSA-N |
| XLogP | 3.67 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|