C16H23N — CID 146662317
1-cyclohexa-1,5-dien-1-yl-N-[(1R)-1-cyclohex-3-en-1-ylethyl]ethanimine (PubChem CID 146662317) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-N-[(1R)-1-cyclohex-3-en-1-ylethyl]ethanimine.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-N-[(1R)-1-cyclohex-3-en-1-ylethyl]ethanimine |
|---|---|
| PubChem CID | 146662317 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-N-[(1R)-1-cyclohex-3-en-1-ylethyl]ethanimine |
| SMILES | C/C(=N\[C@H](C)C1CC=CCC1)C1=CCCC=C1 |
| InChI | InChI=1S/C16H23N/c1-13(15-9-5-3-6-10-15)17-14(2)16-11-7-4-8-12-16/h3,5,7,11-13,15H,4,6,8-10H2,1-2H3/b17-14+/t13-,15?/m1/s1 |
| InChIKey | NWSXUWNBFVOHFM-FEZKZBORSA-N |
| XLogP | 4.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|