C17H22N4O4S — CID 146665893
N-tert-butyl-2-[(4-ethoxyphenyl)sulfonylamino]pyrimidine-5-carboxamide (PubChem CID 146665893) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-tert-butyl-2-[(4-ethoxyphenyl)sulfonylamino]pyrimidine-5-carboxamide.
| Compound Name | N-tert-butyl-2-[(4-ethoxyphenyl)sulfonylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 146665893 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-tert-butyl-2-[(4-ethoxyphenyl)sulfonylamino]pyrimidine-5-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ncc(C(=O)NC(C)(C)C)cn2)cc1 |
| InChI | InChI=1S/C17H22N4O4S/c1-5-25-13-6-8-14(9-7-13)26(23,24)21-16-18-10-12(11-19-16)15(22)20-17(2,3)4/h6-11H,5H2,1-4H3,(H,20,22)(H,18,19,21) |
| InChIKey | KDKOTAOPRQKVLN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |