C15H24O2 — CID 146668622
(5-ethoxy-4-methylidenehexa-1,5-dien-2-yl)oxycyclohexane (PubChem CID 146668622) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (5-ethoxy-4-methylidenehexa-1,5-dien-2-yl)oxycyclohexane.
| Compound Name | (5-ethoxy-4-methylidenehexa-1,5-dien-2-yl)oxycyclohexane |
|---|---|
| PubChem CID | 146668622 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (5-ethoxy-4-methylidenehexa-1,5-dien-2-yl)oxycyclohexane |
| SMILES | C=C(CC(=C)C(=C)OCC)OC1CCCCC1 |
| InChI | InChI=1S/C15H24O2/c1-5-16-14(4)12(2)11-13(3)17-15-9-7-6-8-10-15/h15H,2-11H2,1H3 |
| InChIKey | DBVYBPXHDOMZNX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|