C16H18S — CID 146669709
3-ethenyl-1,1-dimethyl-2-[(Z)-prop-1-enyl]indene-5-thiol (PubChem CID 146669709) has the molecular formula C16H18S and a molecular weight of 242.39 g/mol. Its IUPAC name is 3-ethenyl-1,1-dimethyl-2-[(Z)-prop-1-enyl]indene-5-thiol.
| Compound Name | 3-ethenyl-1,1-dimethyl-2-[(Z)-prop-1-enyl]indene-5-thiol |
|---|---|
| PubChem CID | 146669709 |
| Molecular Formula | C16H18S |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-ethenyl-1,1-dimethyl-2-[(Z)-prop-1-enyl]indene-5-thiol |
| SMILES | C=CC1=C(/C=C\C)C(C)(C)c2ccc(S)cc21 |
| InChI | InChI=1S/C16H18S/c1-5-7-14-12(6-2)13-10-11(17)8-9-15(13)16(14,3)4/h5-10,17H,2H2,1,3-4H3/b7-5- |
| InChIKey | DMEPQNBZDZEDNJ-ALCCZGGFSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|