C23H24Cl2N2O — CID 146672003
N-[(R)-[(1S,2R,5S,7S)-1,5-dichloro-2-adamantyl]-phenylmethyl]pyridine-2-carboxamide (PubChem CID 146672003) has the molecular formula C23H24Cl2N2O and a molecular weight of 415.36 g/mol. Its IUPAC name is N-[(R)-[(1S,2R,5S,7S)-1,5-dichloro-2-adamantyl]-phenylmethyl]pyridine-2-carboxamide.
| Compound Name | N-[(R)-[(1S,2R,5S,7S)-1,5-dichloro-2-adamantyl]-phenylmethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146672003 |
| Molecular Formula | C23H24Cl2N2O |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-[(R)-[(1S,2R,5S,7S)-1,5-dichloro-2-adamantyl]-phenylmethyl]pyridine-2-carboxamide |
| SMILES | O=C(N[C@@H](c1ccccc1)[C@H]1C2C[C@H]3C[C@](Cl)(C2)C[C@@]1(Cl)C3)c1ccccn1 |
| InChI | InChI=1S/C23H24Cl2N2O/c24-22-11-15-10-17(13-22)19(23(25,12-15)14-22)20(16-6-2-1-3-7-16)27-21(28)18-8-4-5-9-26-18/h1-9,15,17,19-20H,10-14H2,(H,27,28)/t15-,17?,19+,20-,22-,23-/m0/s1 |
| InChIKey | ATPANOJJLRVLTP-CIRNXKKISA-N |
| XLogP | 5.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|