C18H20Cl2N4O3 — CID 146674415
3-(2,6-dichlorophenyl)-N-(2,6-dimethylmorpholine-4-carboximidoyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 146674415) has the molecular formula C18H20Cl2N4O3 and a molecular weight of 411.29 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-(2,6-dimethylmorpholine-4-carboximidoyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2,6-dichlorophenyl)-N-(2,6-dimethylmorpholine-4-carboximidoyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 146674415 |
| Molecular Formula | C18H20Cl2N4O3 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-(2,6-dimethylmorpholine-4-carboximidoyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | [H]/N=C(/NC(=O)c1c(-c2c(Cl)cccc2Cl)noc1C)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C18H20Cl2N4O3/c1-9-7-24(8-10(2)26-9)18(21)22-17(25)14-11(3)27-23-16(14)15-12(19)5-4-6-13(15)20/h4-6,9-10H,7-8H2,1-3H3,(H2,21,22,25) |
| InChIKey | NSVYTCSEUPIKSB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|