C9H16N4O — CID 146680522
3-amino-N,1-diethyl-N-methylpyrazole-4-carboxamide (PubChem CID 146680522) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-amino-N,1-diethyl-N-methylpyrazole-4-carboxamide.
| Compound Name | 3-amino-N,1-diethyl-N-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 146680522 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3-amino-N,1-diethyl-N-methylpyrazole-4-carboxamide |
| SMILES | CCN(C)C(=O)c1cn(CC)nc1N |
| InChI | InChI=1S/C9H16N4O/c1-4-12(3)9(14)7-6-13(5-2)11-8(7)10/h6H,4-5H2,1-3H3,(H2,10,11) |
| InChIKey | CRXNDPQMSAINLS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |