C26H35NO4 — CID 146682160
(1S,3R,3'S,5'R,6S,7R)-12-(2-hydroxyethyl)-3,3'-dimethyl-5'-(2-methylprop-1-enyl)spiro[12-azatetracyclo[8.5.1.03,7.013,16]hexadeca-10(16),13-diene-6,2'-oxolane]-11,15-dione (PubChem CID 146682160) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is (1S,3R,3'S,5'R,6S,7R)-12-(2-hydroxyethyl)-3,3'-dimethyl-5'-(2-methylprop-1-enyl)spiro[12-azatetracyclo[8.5.1.03,7.013,16]hexadeca-10(16),13-diene-6,2'-oxolane]-11,15-dione.
| Compound Name | (1S,3R,3'S,5'R,6S,7R)-12-(2-hydroxyethyl)-3,3'-dimethyl-5'-(2-methylprop-1-enyl)spiro[12-azatetracyclo[8.5.1.03,7.013,16]hexadeca-10(16),13-diene-6,2'-oxolane]-11,15-dione |
|---|---|
| PubChem CID | 146682160 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | (1S,3R,3'S,5'R,6S,7R)-12-(2-hydroxyethyl)-3,3'-dimethyl-5'-(2-methylprop-1-enyl)spiro[12-azatetracyclo[8.5.1.03,7.013,16]hexadeca-10(16),13-diene-6,2'-oxolane]-11,15-dione |
| SMILES | CC(C)=C[C@H]1C[C@H](C)[C@]2(CC[C@]3(C)C[C@@H]4C(=O)C=C5C4=C(CC[C@H]32)C(=O)N5CCO)O1 |
| InChI | InChI=1S/C26H35NO4/c1-15(2)11-17-12-16(3)26(31-17)8-7-25(4)14-19-21(29)13-20-23(19)18(5-6-22(25)26)24(30)27(20)9-10-28/h11,13,16-17,19,22,28H,5-10,12,14H2,1-4H3/t16-,17-,19+,22+,25+,26-/m0/s1 |
| InChIKey | UYCUVFZLDDQNQU-RYOCPAHOSA-N |
| XLogP | 3.93 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|