C30H46O7 — CID 146682737
(2R,5R)-2-[(2R,3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-5,6-dihydroxy-6-methylheptanoic acid (PubChem CID 146682737) has the molecular formula C30H46O7 and a molecular weight of 518.69 g/mol. Its IUPAC name is (2R,5R)-2-[(2R,3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-5,6-dihydroxy-6-methylheptanoic acid.
| Compound Name | (2R,5R)-2-[(2R,3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-5,6-dihydroxy-6-methylheptanoic acid |
|---|---|
| PubChem CID | 146682737 |
| Molecular Formula | C30H46O7 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | (2R,5R)-2-[(2R,3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-5,6-dihydroxy-6-methylheptanoic acid |
| SMILES | C=C(C)[C@@H]1CC=C2C(=CC[C@]3(C)[C@@H]([C@@H](CC[C@@H](O)C(C)(C)O)C(=O)O)[C@H](O)C[C@@]23C)[C@@]1(C)CCC(=O)O |
| InChI | InChI=1S/C30H46O7/c1-17(2)19-9-10-21-20(28(19,5)14-13-24(33)34)12-15-29(6)25(22(31)16-30(21,29)7)18(26(35)36)8-11-23(32)27(3,4)37/h10,12,18-19,22-23,25,31-32,37H,1,8-9,11,13-16H2,2-7H3,(H,33,34)(H,35,36)/t18-,19+,22-,23-,25+,28+,29-,30+/m1/s1 |
| InChIKey | YEEROKSIOBPFET-JBIWJWGBSA-N |
| XLogP | 4.72 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|