C33H50O5 — CID 51042622
methyl (2R)-2-[(2R,3R,3aR,6S,7S,9bR)-2-hydroxy-6-(3-methoxy-3-oxopropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoate (PubChem CID 51042622) has the molecular formula C33H50O5 and a molecular weight of 526.76 g/mol. Its IUPAC name is methyl (2R)-2-[(2R,3R,3aR,6S,7S,9bR)-2-hydroxy-6-(3-methoxy-3-oxopropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoate.
| Compound Name | methyl (2R)-2-[(2R,3R,3aR,6S,7S,9bR)-2-hydroxy-6-(3-methoxy-3-oxopropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoate |
|---|---|
| PubChem CID | 51042622 |
| Molecular Formula | C33H50O5 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.37 |
| IUPAC Name | methyl (2R)-2-[(2R,3R,3aR,6S,7S,9bR)-2-hydroxy-6-(3-methoxy-3-oxopropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoate |
| SMILES | C=C(CC[C@@H](C(=O)OC)[C@H]1[C@H](O)C[C@@]2(C)C3=CC[C@@H](C(=C)C)[C@](C)(CCC(=O)OC)C3=CC[C@]12C)C(C)C |
| InChI | InChI=1S/C33H50O5/c1-20(2)22(5)11-12-23(30(36)38-10)29-27(34)19-33(8)26-14-13-24(21(3)4)31(6,17-16-28(35)37-9)25(26)15-18-32(29,33)7/h14-15,20,23-24,27,29,34H,3,5,11-13,16-19H2,1-2,4,6-10H3/t23-,24+,27-,29+,31+,32-,33+/m1/s1 |
| InChIKey | VPCZHRULCHEYRV-QSZXRLQHSA-N |
| XLogP | 6.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|