C31H46O5 — CID 162938225
(2R)-2-[(2R,3R,3aR,6S,7R,9bR)-7-ethenyl-2-hydroxy-6-(3-methoxy-3-oxopropyl)-3a,6,9b-trimethyl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoic acid (PubChem CID 162938225) has the molecular formula C31H46O5 and a molecular weight of 498.70 g/mol. Its IUPAC name is (2R)-2-[(2R,3R,3aR,6S,7R,9bR)-7-ethenyl-2-hydroxy-6-(3-methoxy-3-oxopropyl)-3a,6,9b-trimethyl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoic acid.
| Compound Name | (2R)-2-[(2R,3R,3aR,6S,7R,9bR)-7-ethenyl-2-hydroxy-6-(3-methoxy-3-oxopropyl)-3a,6,9b-trimethyl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoic acid |
|---|---|
| PubChem CID | 162938225 |
| Molecular Formula | C31H46O5 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | (2R)-2-[(2R,3R,3aR,6S,7R,9bR)-7-ethenyl-2-hydroxy-6-(3-methoxy-3-oxopropyl)-3a,6,9b-trimethyl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoic acid |
| SMILES | C=C[C@H]1CC=C2C(=CC[C@]3(C)[C@@H]([C@@H](CCC(=C)C(C)C)C(=O)O)[C@H](O)C[C@@]23C)[C@@]1(C)CCC(=O)OC |
| InChI | InChI=1S/C31H46O5/c1-9-21-11-13-24-23(29(21,5)16-15-26(33)36-8)14-17-30(6)27(25(32)18-31(24,30)7)22(28(34)35)12-10-20(4)19(2)3/h9,13-14,19,21-22,25,27,32H,1,4,10-12,15-18H2,2-3,5-8H3,(H,34,35)/t21-,22+,25+,27-,29-,30+,31-/m0/s1 |
| InChIKey | RCEWILKNRUPQQS-VWJPDWQNSA-N |
| XLogP | 6.49 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|