C24H34O6 — CID 146684693
(1S,5R,9R)-1-[[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-5,9-dihydroxy-6-(hydroxymethyl)-2-oxabicyclo[3.3.1]non-6-ene-3,8-dione (PubChem CID 146684693) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is (1S,5R,9R)-1-[[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-5,9-dihydroxy-6-(hydroxymethyl)-2-oxabicyclo[3.3.1]non-6-ene-3,8-dione.
| Compound Name | (1S,5R,9R)-1-[[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-5,9-dihydroxy-6-(hydroxymethyl)-2-oxabicyclo[3.3.1]non-6-ene-3,8-dione |
|---|---|
| PubChem CID | 146684693 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (1S,5R,9R)-1-[[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-5,9-dihydroxy-6-(hydroxymethyl)-2-oxabicyclo[3.3.1]non-6-ene-3,8-dione |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C[C@@]12OC(=O)C[C@@](O)(C(CO)=CC1=O)[C@H]2O |
| InChI | InChI=1S/C24H34O6/c1-14-6-7-17-21(2,3)8-5-9-22(17,4)16(14)11-24-18(26)10-15(13-25)23(29,20(24)28)12-19(27)30-24/h10,16-17,20,25,28-29H,1,5-9,11-13H2,2-4H3/t16-,17-,20+,22+,23+,24+/m0/s1 |
| InChIKey | KEWKLOYQCZOZIL-UNFUUYLFSA-N |
| XLogP | 2.45 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|