C21H20Cl2F2N2 — CID 146687089
6,7-dichloro-N-[(2,6-difluorophenyl)methyl]spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine (PubChem CID 146687089) has the molecular formula C21H20Cl2F2N2 and a molecular weight of 409.31 g/mol. Its IUPAC name is 6,7-dichloro-N-[(2,6-difluorophenyl)methyl]spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine.
| Compound Name | 6,7-dichloro-N-[(2,6-difluorophenyl)methyl]spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine |
|---|---|
| PubChem CID | 146687089 |
| Molecular Formula | C21H20Cl2F2N2 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 6,7-dichloro-N-[(2,6-difluorophenyl)methyl]spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine |
| SMILES | Fc1cccc(F)c1C/N=C1\Nc2cc(Cl)c(Cl)cc2CC12CCCCC2 |
| InChI | InChI=1S/C21H20Cl2F2N2/c22-15-9-13-11-21(7-2-1-3-8-21)20(27-19(13)10-16(15)23)26-12-14-17(24)5-4-6-18(14)25/h4-6,9-10H,1-3,7-8,11-12H2,(H,26,27) |
| InChIKey | PSZDZOKOEVOYTC-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|