About 1-buta-1,3-diynyl-4-chlorobenzene
1-buta-1,3-diynyl-4-chlorobenzene (PubChem CID 14669596) has the molecular formula C10H5Cl
and a molecular weight of 160.60 g/mol. Its IUPAC name is 1-buta-1,3-diynyl-4-chlorobenzene.
Molecular Properties
| Compound Name | 1-buta-1,3-diynyl-4-chlorobenzene |
| PubChem CID | 14669596 |
| Molecular Formula | C10H5Cl |
| Molecular Weight | 160.60 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 1-buta-1,3-diynyl-4-chlorobenzene |
| SMILES | C#CC#Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H5Cl/c1-2-3-4-9-5-7-10(11)8-6-9/h1,5-8H |
| InChIKey | KSHYVBAPJPABTQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.60 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-buta-1,3-diynyl-4-chlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-1,3-diynyl-4-chlorobenzene?
The IUPAC name of 1-buta-1,3-diynyl-4-chlorobenzene (CID 14669596) is 1-buta-1,3-diynyl-4-chlorobenzene.
What is the SMILES notation for 1-buta-1,3-diynyl-4-chlorobenzene?
The canonical SMILES for 1-buta-1,3-diynyl-4-chlorobenzene is C#CC#Cc1ccc(Cl)cc1.
What is the InChIKey of 1-buta-1,3-diynyl-4-chlorobenzene?
The InChIKey is KSHYVBAPJPABTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl/c1-2-3-4-9-5-7-10(11)8-6-9/h1,5-8H.
What are the key properties of 1-buta-1,3-diynyl-4-chlorobenzene?
1-buta-1,3-diynyl-4-chlorobenzene has a molecular weight of 160.60 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-1,3-diynyl-4-chlorobenzene is sourced from PubChem (CID 14669596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).