C20H16N10 — CID 14670367
6-[10-(4,6-diamino-1,3,5-triazin-2-yl)anthracen-9-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 14670367) has the molecular formula C20H16N10 and a molecular weight of 396.42 g/mol. Its IUPAC name is 6-[10-(4,6-diamino-1,3,5-triazin-2-yl)anthracen-9-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[10-(4,6-diamino-1,3,5-triazin-2-yl)anthracen-9-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 14670367 |
| Molecular Formula | C20H16N10 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 6-[10-(4,6-diamino-1,3,5-triazin-2-yl)anthracen-9-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2c3ccccc3c(-c3nc(N)nc(N)n3)c3ccccc23)n1 |
| InChI | InChI=1S/C20H16N10/c21-17-25-15(26-18(22)29-17)13-9-5-1-2-6-10(9)14(12-8-4-3-7-11(12)13)16-27-19(23)30-20(24)28-16/h1-8H,(H4,21,22,25,26,29)(H4,23,24,27,28,30) |
| InChIKey | FUDYOKKXHRMYDH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 181.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|