C19H27NO3 — CID 146709441
cyclopentyl (2R)-2-[2-(4-aminophenyl)-2-oxoethyl]-4-methylpentanoate (PubChem CID 146709441) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is cyclopentyl (2R)-2-[2-(4-aminophenyl)-2-oxoethyl]-4-methylpentanoate.
| Compound Name | cyclopentyl (2R)-2-[2-(4-aminophenyl)-2-oxoethyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 146709441 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | cyclopentyl (2R)-2-[2-(4-aminophenyl)-2-oxoethyl]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](CC(=O)c1ccc(N)cc1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C19H27NO3/c1-13(2)11-15(19(22)23-17-5-3-4-6-17)12-18(21)14-7-9-16(20)10-8-14/h7-10,13,15,17H,3-6,11-12,20H2,1-2H3/t15-/m1/s1 |
| InChIKey | RAIYBUSBAXCNAG-OAHLLOKOSA-N |
| XLogP | 3.99 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|