C27H28N2O3 — CID 146712664
[5-[[methyl(3-phenoxypropyl)amino]methyl]-1,2-oxazol-3-yl]-diphenylmethanol (PubChem CID 146712664) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is [5-[[methyl(3-phenoxypropyl)amino]methyl]-1,2-oxazol-3-yl]-diphenylmethanol.
| Compound Name | [5-[[methyl(3-phenoxypropyl)amino]methyl]-1,2-oxazol-3-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 146712664 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | [5-[[methyl(3-phenoxypropyl)amino]methyl]-1,2-oxazol-3-yl]-diphenylmethanol |
| SMILES | CN(CCCOc1ccccc1)Cc1cc(C(O)(c2ccccc2)c2ccccc2)no1 |
| InChI | InChI=1S/C27H28N2O3/c1-29(18-11-19-31-24-16-9-4-10-17-24)21-25-20-26(28-32-25)27(30,22-12-5-2-6-13-22)23-14-7-3-8-15-23/h2-10,12-17,20,30H,11,18-19,21H2,1H3 |
| InChIKey | RCGJBZMLIOINER-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|