C28H28N2O4 — CID 87720668
4-[3-[[2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]methyl-methylamino]propoxy]benzaldehyde (PubChem CID 87720668) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 4-[3-[[2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]methyl-methylamino]propoxy]benzaldehyde.
| Compound Name | 4-[3-[[2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]methyl-methylamino]propoxy]benzaldehyde |
|---|---|
| PubChem CID | 87720668 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 4-[3-[[2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]methyl-methylamino]propoxy]benzaldehyde |
| SMILES | CN(CCCOc1ccc(C=O)cc1)Cc1cnc(C(O)(c2ccccc2)c2ccccc2)o1 |
| InChI | InChI=1S/C28H28N2O4/c1-30(17-8-18-33-25-15-13-22(21-31)14-16-25)20-26-19-29-27(34-26)28(32,23-9-4-2-5-10-23)24-11-6-3-7-12-24/h2-7,9-16,19,21,32H,8,17-18,20H2,1H3 |
| InChIKey | FEPBWVBZZYQLPR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|