C27H42N2O3 — CID 70790454
(R)-cyclohexyl-[5-[[8-methoxyoctyl(methyl)amino]methyl]-1,3-oxazol-2-yl]-phenylmethanol (PubChem CID 70790454) has the molecular formula C27H42N2O3 and a molecular weight of 442.64 g/mol. Its IUPAC name is (R)-cyclohexyl-[5-[[8-methoxyoctyl(methyl)amino]methyl]-1,3-oxazol-2-yl]-phenylmethanol.
| Compound Name | (R)-cyclohexyl-[5-[[8-methoxyoctyl(methyl)amino]methyl]-1,3-oxazol-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 70790454 |
| Molecular Formula | C27H42N2O3 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | (R)-cyclohexyl-[5-[[8-methoxyoctyl(methyl)amino]methyl]-1,3-oxazol-2-yl]-phenylmethanol |
| SMILES | COCCCCCCCCN(C)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1 |
| InChI | InChI=1S/C27H42N2O3/c1-29(19-13-5-3-4-6-14-20-31-2)22-25-21-28-26(32-25)27(30,23-15-9-7-10-16-23)24-17-11-8-12-18-24/h7,9-10,15-16,21,24,30H,3-6,8,11-14,17-20,22H2,1-2H3/t27-/m0/s1 |
| InChIKey | BVOCUARVGAULEO-MHZLTWQESA-N |
| XLogP | 5.91 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|