C21H28N2O2 — CID 59317092
(R)-cyclohexyl-phenyl-[5-(pyrrolidin-1-ylmethyl)-1,3-oxazol-2-yl]methanol (PubChem CID 59317092) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (R)-cyclohexyl-phenyl-[5-(pyrrolidin-1-ylmethyl)-1,3-oxazol-2-yl]methanol.
| Compound Name | (R)-cyclohexyl-phenyl-[5-(pyrrolidin-1-ylmethyl)-1,3-oxazol-2-yl]methanol |
|---|---|
| PubChem CID | 59317092 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (R)-cyclohexyl-phenyl-[5-(pyrrolidin-1-ylmethyl)-1,3-oxazol-2-yl]methanol |
| SMILES | O[C@](c1ccccc1)(c1ncc(CN2CCCC2)o1)C1CCCCC1 |
| InChI | InChI=1S/C21H28N2O2/c24-21(17-9-3-1-4-10-17,18-11-5-2-6-12-18)20-22-15-19(25-20)16-23-13-7-8-14-23/h1,3-4,9-10,15,18,24H,2,5-8,11-14,16H2/t21-/m0/s1 |
| InChIKey | VAAXLWROMLCRAU-NRFANRHFSA-N |
| XLogP | 4.09 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |