C28H37N2O2+ — CID 59317021
[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenylpropyl)azanium (PubChem CID 59317021) has the molecular formula C28H37N2O2+ and a molecular weight of 433.62 g/mol. Its IUPAC name is [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenylpropyl)azanium.
| Compound Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenylpropyl)azanium |
|---|---|
| PubChem CID | 59317021 |
| Molecular Formula | C28H37N2O2+ |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenylpropyl)azanium |
| SMILES | C[N+](C)(CCCc1ccccc1)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1 |
| InChI | InChI=1S/C28H37N2O2/c1-30(2,20-12-15-23-13-6-3-7-14-23)22-26-21-29-27(32-26)28(31,24-16-8-4-9-17-24)25-18-10-5-11-19-25/h3-4,6-9,13-14,16-17,21,25,31H,5,10-12,15,18-20,22H2,1-2H3/q+1/t28-/m0/s1 |
| InChIKey | FBWJNADVRSMUAC-NDEPHWFRSA-N |
| XLogP | 5.70 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|