C34H49N2O4+ — CID 25002432
[2-(cyclooctyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-[2-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methoxy]ethyl]azanium (PubChem CID 25002432) has the molecular formula C34H49N2O4+ and a molecular weight of 549.78 g/mol. Its IUPAC name is [2-(cyclooctyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-[2-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methoxy]ethyl]azanium.
| Compound Name | [2-(cyclooctyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-[2-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methoxy]ethyl]azanium |
|---|---|
| PubChem CID | 25002432 |
| Molecular Formula | C34H49N2O4+ |
| Molecular Weight | 549.78 g/mol |
| Exact Mass | 549.37 |
| IUPAC Name | [2-(cyclooctyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-[2-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methoxy]ethyl]azanium |
| SMILES | CC(C)(C)Oc1ccc(COCC[N+](C)(C)Cc2cnc(C(O)(c3ccccc3)C3CCCCCCC3)o2)cc1 |
| InChI | InChI=1S/C34H49N2O4/c1-33(2,3)40-30-20-18-27(19-21-30)26-38-23-22-36(4,5)25-31-24-35-32(39-31)34(37,29-16-12-9-13-17-29)28-14-10-7-6-8-11-15-28/h9,12-13,16-21,24,28,37H,6-8,10-11,14-15,22-23,25-26H2,1-5H3/q+1 |
| InChIKey | RFJPSJCKFRVPIJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.78 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|