C28H36FN2O3+ — CID 59317047
[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-[3-(4-fluorophenoxy)propyl]-dimethylazanium (PubChem CID 59317047) has the molecular formula C28H36FN2O3+ and a molecular weight of 467.61 g/mol. Its IUPAC name is [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-[3-(4-fluorophenoxy)propyl]-dimethylazanium.
| Compound Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-[3-(4-fluorophenoxy)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 59317047 |
| Molecular Formula | C28H36FN2O3+ |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-[3-(4-fluorophenoxy)propyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCOc1ccc(F)cc1)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1 |
| InChI | InChI=1S/C28H36FN2O3/c1-31(2,18-9-19-33-25-16-14-24(29)15-17-25)21-26-20-30-27(34-26)28(32,22-10-5-3-6-11-22)23-12-7-4-8-13-23/h3,5-6,10-11,14-17,20,23,32H,4,7-9,12-13,18-19,21H2,1-2H3/q+1/t28-/m0/s1 |
| InChIKey | WJVMLHBCUCXDDI-NDEPHWFRSA-N |
| XLogP | 5.68 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|