C27H35BrN2O3 — CID 159912607
[2-[(S)-cyclopentyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium bromide (PubChem CID 159912607) has the molecular formula C27H35BrN2O3 and a molecular weight of 515.49 g/mol. Its IUPAC name is [2-[(S)-cyclopentyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium bromide.
| Compound Name | [2-[(S)-cyclopentyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium bromide |
|---|---|
| PubChem CID | 159912607 |
| Molecular Formula | C27H35BrN2O3 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | [2-[(S)-cyclopentyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium bromide |
| SMILES | C[N+](C)(CCCOc1ccccc1)Cc1cnc([C@@](O)(c2ccccc2)C2CCCC2)o1.[Br-] |
| InChI | InChI=1S/C27H35N2O3.BrH/c1-29(2,18-11-19-31-24-16-7-4-8-17-24)21-25-20-28-26(32-25)27(30,23-14-9-10-15-23)22-12-5-3-6-13-22;/h3-8,12-13,16-17,20,23,30H,9-11,14-15,18-19,21H2,1-2H3;1H/q+1;/p-1/t27-;/m1./s1 |
| InChIKey | VKFLUCYPYZVWRG-HZPIKELBSA-M |
| XLogP | 2.15 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|