C25H37BrN2O2 — CID 87449883
[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(4-methylpent-3-enyl)azanium bromide (PubChem CID 87449883) has the molecular formula C25H37BrN2O2 and a molecular weight of 477.49 g/mol. Its IUPAC name is [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(4-methylpent-3-enyl)azanium bromide.
| Compound Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(4-methylpent-3-enyl)azanium bromide |
|---|---|
| PubChem CID | 87449883 |
| Molecular Formula | C25H37BrN2O2 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | [2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(4-methylpent-3-enyl)azanium bromide |
| SMILES | CC(C)=CCC[N+](C)(C)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1.[Br-] |
| InChI | InChI=1S/C25H37N2O2.BrH/c1-20(2)12-11-17-27(3,4)19-23-18-26-24(29-23)25(28,21-13-7-5-8-14-21)22-15-9-6-10-16-22;/h5,7-8,12-14,18,22,28H,6,9-11,15-17,19H2,1-4H3;1H/q+1;/p-1/t25-;/m0./s1 |
| InChIKey | MDZSKYCCIHTBAA-UQIIZPHYSA-M |
| XLogP | 2.43 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|